What is the formula of M dinitrobenzene?
1,3-Dinitrobenzene
| PubChem CID | 7452 |
|---|---|
| Molecular Formula | C6H4N2O4 or C6H4(NO2)2 |
| Synonyms | 1,3-Dinitrobenzene 99-65-0 M-DINITROBENZENE 2,4-Dinitrobenzene Benzene, 1,3-dinitro- More… |
| Molecular Weight | 168.11 |
| Dates | Modify 2022-04-02 Create 2005-03-26 |
What is the chemical name of acetanilide?
N-phenylacetamide
N-phenylethanamide
Acetanilide/IUPAC ID
What is use of acetanilide Mcq?
Acetanilide is used in the synthesis of penicillin and in other pharmaceuticals. It is also used as an antipyretic agent means fever reducing agent.
Is acetanilide a functional group?
Acetanilide has an amide functional group, meaning it has a nitrogen atom bonded directly to a carbonyl (carbon-oxygen double bond).
How do you make M nitroaniline from M-dinitrobenzene?
Principle: m-nitroaniline unlike o and p-nitroaniline cannot be prepared by direct nitration of Aniline. It has therefore to be prepared by reducing only one of the nitro groups in m-Dinitrobenzene. This selective reduction can be achieved by boiling an aqueous suspension of m-Dinitrobenzene with sodium disulphide.
How is acetanilide metabolized?
The route of metabolism of acetanilide in man was shown to be as follows: a minor fraction of the drug deacetylates to form aniline; this compound was shown to be the precursor of the substance which oxidizes hemoglobin to methemoglobin; the major fraction of the drug is oxidized to N-acetyl p-aminophenol; this …
What is the name of ch3cocl?
acetyl chloride
| IUPAC Name | acetyl chloride |
|---|---|
| Alternative Names | Ethanoyl chloride |
| Molecular Formula | C2H3ClO |
| Molar Mass | 78.495 g/mol |
| InChI | InChI=1S/C2H3ClO/c1-2(3)4/h1H3 |
How do you calculate acetanilide yield?
PROCEDURE
- 10 g of aniline shall yield acetanilide = 135.16 / 93 × 10 = 14.5 g.
- Then, Percentage Practical yield = Practical yield / Theoretical yield × 100.
- = 12 / 14.5 × 100 = 82.75 %
How do you nitrate acetanilide?
Procedure – Nitration of Acetanilide. Place 6.5 g of acetanilide in a 125-mL Erlenmeyer flask, add 10 mL of glacial acetic acid (CAUTION: strong irritant), and warm the flask on a steam bath until the acetanilide dissolves.
What is the percent yield of nitration of acetanilide?
The percent yield of this reaction for the recrystallized product was 59.3% of methyl nitrobenzoate, while it was 6.75% for nitroacetanilide. Figure 1: The reaction for the nitration of acetanilide. Figure 2: The reaction for the nitration of methyl benzoate.
How do you make methyl Nitro benzoate from acetanilide?
Nitration of Acetanilide and Methyl Benzoate by Electrophilic Aromatic Substitution The purpose of this experiment was to synthesize methyl nitro benzoate from methyl benzoate, as well as nitroacetanilide from concentrated nitric acid (HNO 3), and concentrated sulfuric acid (H 2 SO 4) by using an electrophilic aromatic substitution reaction.
What is the difference between methyl benzoate nitration and acetanilide nitration?
The methyl benzoate nitration formed white solid, and the acetanilide nitration for a light yellow solid. The crystals were the vacuum filtered with a Buchner funnel.